C9H8BrF2N — CID 130898055
(1S)-1-(4-bromo-2,6-difluorophenyl)prop-2-en-1-amine (PubChem CID 130898055) has the molecular formula C9H8BrF2N and a molecular weight of 248.07 g/mol. Its IUPAC name is (1S)-1-(4-bromo-2,6-difluorophenyl)prop-2-en-1-amine.
| Compound Name | (1S)-1-(4-bromo-2,6-difluorophenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 130898055 |
| Molecular Formula | C9H8BrF2N |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | (1S)-1-(4-bromo-2,6-difluorophenyl)prop-2-en-1-amine |
| SMILES | C=C[C@H](N)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C9H8BrF2N/c1-2-8(13)9-6(11)3-5(10)4-7(9)12/h2-4,8H,1,13H2/t8-/m0/s1 |
| InChIKey | YNEWUJBDUVJMOF-QMMMGPOBSA-N |
| XLogP | 2.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|