C8H8BrF2N — CID 67403497
1-(4-bromo-2,6-difluorophenyl)ethanamine (PubChem CID 67403497) has the molecular formula C8H8BrF2N and a molecular weight of 236.06 g/mol. Its IUPAC name is 1-(4-bromo-2,6-difluorophenyl)ethanamine.
| Compound Name | 1-(4-bromo-2,6-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 67403497 |
| Molecular Formula | C8H8BrF2N |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 1-(4-bromo-2,6-difluorophenyl)ethanamine |
| SMILES | CC(N)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C8H8BrF2N/c1-4(12)8-6(10)2-5(9)3-7(8)11/h2-4H,12H2,1H3 |
| InChIKey | RKEWVQWENMZJIB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |