C10H13BrF2N2 — CID 105281800
[1-(4-bromo-2,6-difluorophenyl)-2-methylpropyl]hydrazine (PubChem CID 105281800) has the molecular formula C10H13BrF2N2 and a molecular weight of 279.13 g/mol. Its IUPAC name is [1-(4-bromo-2,6-difluorophenyl)-2-methylpropyl]hydrazine.
| Compound Name | [1-(4-bromo-2,6-difluorophenyl)-2-methylpropyl]hydrazine |
|---|---|
| PubChem CID | 105281800 |
| Molecular Formula | C10H13BrF2N2 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | [1-(4-bromo-2,6-difluorophenyl)-2-methylpropyl]hydrazine |
| SMILES | CC(C)C(NN)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H13BrF2N2/c1-5(2)10(15-14)9-7(12)3-6(11)4-8(9)13/h3-5,10,15H,14H2,1-2H3 |
| InChIKey | RFQQSSXAHRVLQX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|