C12H15BrF2N2 — CID 105320470
[1-(4-bromo-2,6-difluorophenyl)-3-methylidenepentyl]hydrazine (PubChem CID 105320470) has the molecular formula C12H15BrF2N2 and a molecular weight of 305.17 g/mol. Its IUPAC name is [1-(4-bromo-2,6-difluorophenyl)-3-methylidenepentyl]hydrazine.
| Compound Name | [1-(4-bromo-2,6-difluorophenyl)-3-methylidenepentyl]hydrazine |
|---|---|
| PubChem CID | 105320470 |
| Molecular Formula | C12H15BrF2N2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | [1-(4-bromo-2,6-difluorophenyl)-3-methylidenepentyl]hydrazine |
| SMILES | C=C(CC)CC(NN)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H15BrF2N2/c1-3-7(2)4-11(17-16)12-9(14)5-8(13)6-10(12)15/h5-6,11,17H,2-4,16H2,1H3 |
| InChIKey | ORVBSHYDJMVSSH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|