C11H12BrF2N5 — CID 107066747
[1-(4-bromo-2,6-difluorophenyl)-2-(1-methyltriazol-4-yl)ethyl]hydrazine (PubChem CID 107066747) has the molecular formula C11H12BrF2N5 and a molecular weight of 332.15 g/mol. Its IUPAC name is [1-(4-bromo-2,6-difluorophenyl)-2-(1-methyltriazol-4-yl)ethyl]hydrazine.
| Compound Name | [1-(4-bromo-2,6-difluorophenyl)-2-(1-methyltriazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107066747 |
| Molecular Formula | C11H12BrF2N5 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | [1-(4-bromo-2,6-difluorophenyl)-2-(1-methyltriazol-4-yl)ethyl]hydrazine |
| SMILES | Cn1cc(CC(NN)c2c(F)cc(Br)cc2F)nn1 |
| InChI | InChI=1S/C11H12BrF2N5/c1-19-5-7(17-18-19)4-10(16-15)11-8(13)2-6(12)3-9(11)14/h2-3,5,10,16H,4,15H2,1H3 |
| InChIKey | HSUBMMZTEOUSCN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|