C7H11N7S — CID 107066667
[2-(1-methyltriazol-4-yl)-1-(thiadiazol-5-yl)ethyl]hydrazine (PubChem CID 107066667) has the molecular formula C7H11N7S and a molecular weight of 225.28 g/mol. Its IUPAC name is [2-(1-methyltriazol-4-yl)-1-(thiadiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(1-methyltriazol-4-yl)-1-(thiadiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107066667 |
| Molecular Formula | C7H11N7S |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | [2-(1-methyltriazol-4-yl)-1-(thiadiazol-5-yl)ethyl]hydrazine |
| SMILES | Cn1cc(CC(NN)c2cnns2)nn1 |
| InChI | InChI=1S/C7H11N7S/c1-14-4-5(11-12-14)2-6(10-8)7-3-9-13-15-7/h3-4,6,10H,2,8H2,1H3 |
| InChIKey | HGHFDXCPQLBCRX-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|