C10H14N6 — CID 107065906
[2-(1-methyltriazol-4-yl)-1-pyridin-2-ylethyl]hydrazine (PubChem CID 107065906) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is [2-(1-methyltriazol-4-yl)-1-pyridin-2-ylethyl]hydrazine.
| Compound Name | [2-(1-methyltriazol-4-yl)-1-pyridin-2-ylethyl]hydrazine |
|---|---|
| PubChem CID | 107065906 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | [2-(1-methyltriazol-4-yl)-1-pyridin-2-ylethyl]hydrazine |
| SMILES | Cn1cc(CC(NN)c2ccccn2)nn1 |
| InChI | InChI=1S/C10H14N6/c1-16-7-8(14-15-16)6-10(13-11)9-4-2-3-5-12-9/h2-5,7,10,13H,6,11H2,1H3 |
| InChIKey | JXLOODZFHGNIHO-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|