C14H17N7 — CID 107066649
[2-(1-methyltriazol-4-yl)-1-(1-phenylpyrazol-3-yl)ethyl]hydrazine (PubChem CID 107066649) has the molecular formula C14H17N7 and a molecular weight of 283.34 g/mol. Its IUPAC name is [2-(1-methyltriazol-4-yl)-1-(1-phenylpyrazol-3-yl)ethyl]hydrazine.
| Compound Name | [2-(1-methyltriazol-4-yl)-1-(1-phenylpyrazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107066649 |
| Molecular Formula | C14H17N7 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | [2-(1-methyltriazol-4-yl)-1-(1-phenylpyrazol-3-yl)ethyl]hydrazine |
| SMILES | Cn1cc(CC(NN)c2ccn(-c3ccccc3)n2)nn1 |
| InChI | InChI=1S/C14H17N7/c1-20-10-11(17-19-20)9-14(16-15)13-7-8-21(18-13)12-5-3-2-4-6-12/h2-8,10,14,16H,9,15H2,1H3 |
| InChIKey | ASAFOKVLLAZDQK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|