C12H16FN5 — CID 107050554
N-ethyl-1-(3-fluoro-2-pyridinyl)-2-(1-methyltriazol-4-yl)ethanamine (PubChem CID 107050554) has the molecular formula C12H16FN5 and a molecular weight of 249.29 g/mol. Its IUPAC name is N-ethyl-1-(3-fluoro-2-pyridinyl)-2-(1-methyltriazol-4-yl)ethanamine.
| Compound Name | N-ethyl-1-(3-fluoro-2-pyridinyl)-2-(1-methyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 107050554 |
| Molecular Formula | C12H16FN5 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-ethyl-1-(3-fluoro-2-pyridinyl)-2-(1-methyltriazol-4-yl)ethanamine |
| SMILES | CCNC(Cc1cn(C)nn1)c1ncccc1F |
| InChI | InChI=1S/C12H16FN5/c1-3-14-11(7-9-8-18(2)17-16-9)12-10(13)5-4-6-15-12/h4-6,8,11,14H,3,7H2,1-2H3 |
| InChIKey | REKUBHCNOILNLZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |