C11H14BrF2N — CID 131315667
(1R)-1-(4-bromo-2,6-difluorophenyl)-3-methylbutan-1-amine (PubChem CID 131315667) has the molecular formula C11H14BrF2N and a molecular weight of 278.14 g/mol. Its IUPAC name is (1R)-1-(4-bromo-2,6-difluorophenyl)-3-methylbutan-1-amine.
| Compound Name | (1R)-1-(4-bromo-2,6-difluorophenyl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 131315667 |
| Molecular Formula | C11H14BrF2N |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (1R)-1-(4-bromo-2,6-difluorophenyl)-3-methylbutan-1-amine |
| SMILES | CC(C)C[C@@H](N)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H14BrF2N/c1-6(2)3-10(15)11-8(13)4-7(12)5-9(11)14/h4-6,10H,3,15H2,1-2H3/t10-/m1/s1 |
| InChIKey | JUGHUTLNVQIDHV-SNVBAGLBSA-N |
| XLogP | 3.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |