C11H16BrClF2N2 — CID 171206699
(1R)-1-(4-bromo-2,6-difluorophenyl)pentane-1,5-diamine;hydrochloride (PubChem CID 171206699) has the molecular formula C11H16BrClF2N2 and a molecular weight of 329.62 g/mol. Its IUPAC name is (1R)-1-(4-bromo-2,6-difluorophenyl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-(4-bromo-2,6-difluorophenyl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171206699 |
| Molecular Formula | C11H16BrClF2N2 |
| Molecular Weight | 329.62 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | (1R)-1-(4-bromo-2,6-difluorophenyl)pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H15BrF2N2.ClH/c12-7-5-8(13)11(9(14)6-7)10(16)3-1-2-4-15;/h5-6,10H,1-4,15-16H2;1H/t10-;/m1./s1 |
| InChIKey | UNFMVTBDCQHCNL-HNCPQSOCSA-N |
| XLogP | 3.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|