C9H10Br2FNO — CID 130774352
(3R)-3-amino-3-(2,4-dibromo-6-fluorophenyl)propan-1-ol (PubChem CID 130774352) has the molecular formula C9H10Br2FNO and a molecular weight of 326.99 g/mol. Its IUPAC name is (3R)-3-amino-3-(2,4-dibromo-6-fluorophenyl)propan-1-ol.
| Compound Name | (3R)-3-amino-3-(2,4-dibromo-6-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 130774352 |
| Molecular Formula | C9H10Br2FNO |
| Molecular Weight | 326.99 g/mol |
| Exact Mass | 324.91 |
| IUPAC Name | (3R)-3-amino-3-(2,4-dibromo-6-fluorophenyl)propan-1-ol |
| SMILES | N[C@H](CCO)c1c(F)cc(Br)cc1Br |
| InChI | InChI=1S/C9H10Br2FNO/c10-5-3-6(11)9(7(12)4-5)8(13)1-2-14/h3-4,8,14H,1-2,13H2/t8-/m1/s1 |
| InChIKey | AKQGJBKYCMGCBZ-MRVPVSSYSA-N |
| XLogP | 2.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.99 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |