C10H12BrF2N — CID 83402968
1-(4-bromo-2,6-difluorophenyl)-2-methylpropan-1-amine (PubChem CID 83402968) has the molecular formula C10H12BrF2N and a molecular weight of 264.11 g/mol. Its IUPAC name is 1-(4-bromo-2,6-difluorophenyl)-2-methylpropan-1-amine.
| Compound Name | 1-(4-bromo-2,6-difluorophenyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 83402968 |
| Molecular Formula | C10H12BrF2N |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 1-(4-bromo-2,6-difluorophenyl)-2-methylpropan-1-amine |
| SMILES | CC(C)C(N)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H12BrF2N/c1-5(2)10(14)9-7(12)3-6(11)4-8(9)13/h3-5,10H,14H2,1-2H3 |
| InChIKey | OIAFIOYEMAWECR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |