C10H12F3N — CID 43198662
2-methyl-1-(2,4,6-trifluorophenyl)propan-1-amine (PubChem CID 43198662) has the molecular formula C10H12F3N and a molecular weight of 203.21 g/mol. Its IUPAC name is 2-methyl-1-(2,4,6-trifluorophenyl)propan-1-amine.
| Compound Name | 2-methyl-1-(2,4,6-trifluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 43198662 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-methyl-1-(2,4,6-trifluorophenyl)propan-1-amine |
| SMILES | CC(C)C(N)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H12F3N/c1-5(2)10(14)9-7(12)3-6(11)4-8(9)13/h3-5,10H,14H2,1-2H3 |
| InChIKey | QTITXKLOJQICHV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |