C10H12F3NO2S — CID 113421976
2-methylsulfonyl-1-(2,4,6-trifluorophenyl)propan-1-amine (PubChem CID 113421976) has the molecular formula C10H12F3NO2S and a molecular weight of 267.27 g/mol. Its IUPAC name is 2-methylsulfonyl-1-(2,4,6-trifluorophenyl)propan-1-amine.
| Compound Name | 2-methylsulfonyl-1-(2,4,6-trifluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 113421976 |
| Molecular Formula | C10H12F3NO2S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-methylsulfonyl-1-(2,4,6-trifluorophenyl)propan-1-amine |
| SMILES | CC(C(N)c1c(F)cc(F)cc1F)S(C)(=O)=O |
| InChI | InChI=1S/C10H12F3NO2S/c1-5(17(2,15)16)10(14)9-7(12)3-6(11)4-8(9)13/h3-5,10H,14H2,1-2H3 |
| InChIKey | ARLJLXFMHZPOIH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |