About 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol
2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol (PubChem CID 131053212) has the molecular formula C8H8BrF2NO
and a molecular weight of 252.06 g/mol. Its IUPAC name is 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol.
Molecular Properties
| Compound Name | 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol |
| PubChem CID | 131053212 |
| Molecular Formula | C8H8BrF2NO |
| Molecular Weight | 252.06 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol |
| SMILES | C[C@@H](N)c1c(F)cc(F)c(Br)c1O |
| InChI | InChI=1S/C8H8BrF2NO/c1-3(12)6-4(10)2-5(11)7(9)8(6)13/h2-3,13H,12H2,1H3/t3-/m1/s1 |
| InChIKey | MLRSTMBHDIIQEP-GSVOUGTGSA-N |
| XLogP | 2.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.06 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol?
The IUPAC name of 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol (CID 131053212) is 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol.
What is the SMILES notation for 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol?
The canonical SMILES for 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol is C[C@@H](N)c1c(F)cc(F)c(Br)c1O.
What is the InChIKey of 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol?
The InChIKey is MLRSTMBHDIIQEP-GSVOUGTGSA-N. The full InChI is InChI=1S/C8H8BrF2NO/c1-3(12)6-4(10)2-5(11)7(9)8(6)13/h2-3,13H,12H2,1H3/t3-/m1/s1.
What are the key properties of 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol?
2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol has a molecular weight of 252.06 g/mol, XLogP of 2.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-1-aminoethyl]-6-bromo-3,5-difluorophenol is sourced from PubChem (CID 131053212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).