C9H8F2N2 — CID 55292784
4-[(1R)-1-aminoethyl]-3,5-difluorobenzonitrile (PubChem CID 55292784) has the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. Its IUPAC name is 4-[(1R)-1-aminoethyl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[(1R)-1-aminoethyl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 55292784 |
| Molecular Formula | C9H8F2N2 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 4-[(1R)-1-aminoethyl]-3,5-difluorobenzonitrile |
| SMILES | C[C@@H](N)c1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C9H8F2N2/c1-5(13)9-7(10)2-6(4-12)3-8(9)11/h2-3,5H,13H2,1H3/t5-/m1/s1 |
| InChIKey | QXERSYRHFHRBIB-RXMQYKEDSA-N |
| XLogP | 1.86 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |