C9H11BrClNO2 — CID 171891492
4-bromo-1-(2-chloro-4-pyridinyl)butane-1,2-diol (PubChem CID 171891492) has the molecular formula C9H11BrClNO2 and a molecular weight of 280.55 g/mol. Its IUPAC name is 4-bromo-1-(2-chloro-4-pyridinyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(2-chloro-4-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171891492 |
| Molecular Formula | C9H11BrClNO2 |
| Molecular Weight | 280.55 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | 4-bromo-1-(2-chloro-4-pyridinyl)butane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C9H11BrClNO2/c10-3-1-7(13)9(14)6-2-4-12-8(11)5-6/h2,4-5,7,9,13-14H,1,3H2 |
| InChIKey | WWMOQPLDPZSQKW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.55 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|