C7H5ClF3NO — CID 89034053
(1R)-1-(2-chloro-4-pyridinyl)-2,2,2-trifluoroethanol (PubChem CID 89034053) has the molecular formula C7H5ClF3NO and a molecular weight of 211.57 g/mol. Its IUPAC name is (1R)-1-(2-chloro-4-pyridinyl)-2,2,2-trifluoroethanol.
| Compound Name | (1R)-1-(2-chloro-4-pyridinyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 89034053 |
| Molecular Formula | C7H5ClF3NO |
| Molecular Weight | 211.57 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | (1R)-1-(2-chloro-4-pyridinyl)-2,2,2-trifluoroethanol |
| SMILES | O[C@H](c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C7H5ClF3NO/c8-5-3-4(1-2-12-5)6(13)7(9,10)11/h1-3,6,13H/t6-/m1/s1 |
| InChIKey | CKRHTOYGHUTCNF-ZCFIWIBFSA-N |
| XLogP | 2.33 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|