C9H13ClN2O — CID 131060387
(1R,2R)-2-amino-1-(2-chloro-4-pyridinyl)butan-1-ol (PubChem CID 131060387) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is (1R,2R)-2-amino-1-(2-chloro-4-pyridinyl)butan-1-ol.
| Compound Name | (1R,2R)-2-amino-1-(2-chloro-4-pyridinyl)butan-1-ol |
|---|---|
| PubChem CID | 131060387 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (1R,2R)-2-amino-1-(2-chloro-4-pyridinyl)butan-1-ol |
| SMILES | CC[C@@H](N)[C@H](O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C9H13ClN2O/c1-2-7(11)9(13)6-3-4-12-8(10)5-6/h3-5,7,9,13H,2,11H2,1H3/t7-,9-/m1/s1 |
| InChIKey | PJSCQQYEMNBJER-VXNVDRBHSA-N |
| XLogP | 1.51 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|