C13H14BrNO2 — CID 171892229
4-bromo-1-isoquinolin-5-ylbutane-1,2-diol (PubChem CID 171892229) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is 4-bromo-1-isoquinolin-5-ylbutane-1,2-diol.
| Compound Name | 4-bromo-1-isoquinolin-5-ylbutane-1,2-diol |
|---|---|
| PubChem CID | 171892229 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 4-bromo-1-isoquinolin-5-ylbutane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1cccc2cnccc12 |
| InChI | InChI=1S/C13H14BrNO2/c14-6-4-12(16)13(17)11-3-1-2-9-8-15-7-5-10(9)11/h1-3,5,7-8,12-13,16-17H,4,6H2 |
| InChIKey | AJINFACXZCDJRV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|