C11H15NO5S — CID 171899451
3,4-dihydroxy-4-(2-methylsulfonylphenyl)butanamide (PubChem CID 171899451) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(2-methylsulfonylphenyl)butanamide.
| Compound Name | 3,4-dihydroxy-4-(2-methylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 171899451 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3,4-dihydroxy-4-(2-methylsulfonylphenyl)butanamide |
| SMILES | CS(=O)(=O)c1ccccc1C(O)C(O)CC(N)=O |
| InChI | InChI=1S/C11H15NO5S/c1-18(16,17)9-5-3-2-4-7(9)11(15)8(13)6-10(12)14/h2-5,8,11,13,15H,6H2,1H3,(H2,12,14) |
| InChIKey | LMSQXRVULZSIGP-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |