C13H18N2O6S2 — CID 20546233
3-[2,6-bis(methylsulfonyl)phenyl]pentanediamide (PubChem CID 20546233) has the molecular formula C13H18N2O6S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[2,6-bis(methylsulfonyl)phenyl]pentanediamide.
| Compound Name | 3-[2,6-bis(methylsulfonyl)phenyl]pentanediamide |
|---|---|
| PubChem CID | 20546233 |
| Molecular Formula | C13H18N2O6S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-[2,6-bis(methylsulfonyl)phenyl]pentanediamide |
| SMILES | CS(=O)(=O)c1cccc(S(C)(=O)=O)c1C(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C13H18N2O6S2/c1-22(18,19)9-4-3-5-10(23(2,20)21)13(9)8(6-11(14)16)7-12(15)17/h3-5,8H,6-7H2,1-2H3,(H2,14,16)(H2,15,17) |
| InChIKey | YOJOEFYARPQQTJ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |