C9H9ClO5S — CID 117416079
2-(2-chloro-6-methylsulfonylphenyl)-2-hydroxyacetic acid (PubChem CID 117416079) has the molecular formula C9H9ClO5S and a molecular weight of 264.69 g/mol. Its IUPAC name is 2-(2-chloro-6-methylsulfonylphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2-chloro-6-methylsulfonylphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117416079 |
| Molecular Formula | C9H9ClO5S |
| Molecular Weight | 264.69 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 2-(2-chloro-6-methylsulfonylphenyl)-2-hydroxyacetic acid |
| SMILES | CS(=O)(=O)c1cccc(Cl)c1C(O)C(=O)O |
| InChI | InChI=1S/C9H9ClO5S/c1-16(14,15)6-4-2-3-5(10)7(6)8(11)9(12)13/h2-4,8,11H,1H3,(H,12,13) |
| InChIKey | CSVPAUWYXAWAEL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.69 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |