C11H15NO6S — CID 171896022
methyl 3,4-dihydroxy-4-(2-sulfamoylphenyl)butanoate (PubChem CID 171896022) has the molecular formula C11H15NO6S and a molecular weight of 289.31 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(2-sulfamoylphenyl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(2-sulfamoylphenyl)butanoate |
|---|---|
| PubChem CID | 171896022 |
| Molecular Formula | C11H15NO6S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(2-sulfamoylphenyl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H15NO6S/c1-18-10(14)6-8(13)11(15)7-4-2-3-5-9(7)19(12,16)17/h2-5,8,11,13,15H,6H2,1H3,(H2,12,16,17) |
| InChIKey | QREWOYYIFFJLFD-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |