C15H16O5 — CID 171896331
methyl 3,4-dihydroxy-4-(1-hydroxynaphthalen-2-yl)butanoate (PubChem CID 171896331) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(1-hydroxynaphthalen-2-yl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(1-hydroxynaphthalen-2-yl)butanoate |
|---|---|
| PubChem CID | 171896331 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(1-hydroxynaphthalen-2-yl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C15H16O5/c1-20-13(17)8-12(16)15(19)11-7-6-9-4-2-3-5-10(9)14(11)18/h2-7,12,15-16,18-19H,8H2,1H3 |
| InChIKey | BJBUMKKQURBXCT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |