C13H16O6 — CID 171895900
3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-methylbenzoic acid (PubChem CID 171895900) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-methylbenzoic acid.
| Compound Name | 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 171895900 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 3-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-methylbenzoic acid |
| SMILES | COC(=O)CC(O)C(O)c1cccc(C(=O)O)c1C |
| InChI | InChI=1S/C13H16O6/c1-7-8(4-3-5-9(7)13(17)18)12(16)10(14)6-11(15)19-2/h3-5,10,12,14,16H,6H2,1-2H3,(H,17,18) |
| InChIKey | BNJGNSMUQSTRBJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |