C11H17NO4S — CID 171881534
4-amino-1-(2-methylsulfonylphenyl)butane-1,2-diol (PubChem CID 171881534) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is 4-amino-1-(2-methylsulfonylphenyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(2-methylsulfonylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171881534 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-amino-1-(2-methylsulfonylphenyl)butane-1,2-diol |
| SMILES | CS(=O)(=O)c1ccccc1C(O)C(O)CCN |
| InChI | InChI=1S/C11H17NO4S/c1-17(15,16)10-5-3-2-4-8(10)11(14)9(13)6-7-12/h2-5,9,11,13-14H,6-7,12H2,1H3 |
| InChIKey | BCBWQSKQTNQRDA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |