C14H21NO4S — CID 175083612
(1R,2R)-2-(butan-2-ylideneamino)-1-(2-methylsulfonylphenyl)propane-1,3-diol (PubChem CID 175083612) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is (1R,2R)-2-(butan-2-ylideneamino)-1-(2-methylsulfonylphenyl)propane-1,3-diol.
| Compound Name | (1R,2R)-2-(butan-2-ylideneamino)-1-(2-methylsulfonylphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 175083612 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (1R,2R)-2-(butan-2-ylideneamino)-1-(2-methylsulfonylphenyl)propane-1,3-diol |
| SMILES | CC/C(C)=N/[C@H](CO)[C@H](O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C14H21NO4S/c1-4-10(2)15-12(9-16)14(17)11-7-5-6-8-13(11)20(3,18)19/h5-8,12,14,16-17H,4,9H2,1-3H3/b15-10+/t12-,14-/m1/s1 |
| InChIKey | COSXSIJRZNQUCT-LHVWTWQCSA-N |
| XLogP | 1.36 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|