C11H16O5S — CID 170818387
1-[2-(methylsulfonylmethyl)phenyl]propane-1,2,3-triol (PubChem CID 170818387) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is 1-[2-(methylsulfonylmethyl)phenyl]propane-1,2,3-triol.
| Compound Name | 1-[2-(methylsulfonylmethyl)phenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818387 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-[2-(methylsulfonylmethyl)phenyl]propane-1,2,3-triol |
| SMILES | CS(=O)(=O)Cc1ccccc1C(O)C(O)CO |
| InChI | InChI=1S/C11H16O5S/c1-17(15,16)7-8-4-2-3-5-9(8)11(14)10(13)6-12/h2-5,10-14H,6-7H2,1H3 |
| InChIKey | LWJBFDISEODVNZ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |