C10H12O5 — CID 170817732
2-hydroxy-6-(1,2,3-trihydroxypropyl)benzaldehyde (PubChem CID 170817732) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-hydroxy-6-(1,2,3-trihydroxypropyl)benzaldehyde.
| Compound Name | 2-hydroxy-6-(1,2,3-trihydroxypropyl)benzaldehyde |
|---|---|
| PubChem CID | 170817732 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-hydroxy-6-(1,2,3-trihydroxypropyl)benzaldehyde |
| SMILES | O=Cc1c(O)cccc1C(O)C(O)CO |
| InChI | InChI=1S/C10H12O5/c11-4-7-6(2-1-3-8(7)13)10(15)9(14)5-12/h1-4,9-10,12-15H,5H2 |
| InChIKey | PUAUFBDMIVGAFU-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|