About 2,6-dihydroxybenzaldehyde;formaldehyde
2,6-dihydroxybenzaldehyde;formaldehyde (PubChem CID 158378810) has the molecular formula C8H8O4
and a molecular weight of 168.15 g/mol. Its IUPAC name is 2,6-dihydroxybenzaldehyde;formaldehyde.
Molecular Properties
| Compound Name | 2,6-dihydroxybenzaldehyde;formaldehyde |
| PubChem CID | 158378810 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 2,6-dihydroxybenzaldehyde;formaldehyde |
| SMILES | C=O.O=Cc1c(O)cccc1O |
| InChI | InChI=1S/C7H6O3.CH2O/c8-4-5-6(9)2-1-3-7(5)10;1-2/h1-4,9-10H;1H2 |
| InChIKey | GVNNIHSAJXXMJC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dihydroxybenzaldehyde;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dihydroxybenzaldehyde;formaldehyde?
The IUPAC name of 2,6-dihydroxybenzaldehyde;formaldehyde (CID 158378810) is 2,6-dihydroxybenzaldehyde;formaldehyde.
What is the SMILES notation for 2,6-dihydroxybenzaldehyde;formaldehyde?
The canonical SMILES for 2,6-dihydroxybenzaldehyde;formaldehyde is C=O.O=Cc1c(O)cccc1O.
What is the InChIKey of 2,6-dihydroxybenzaldehyde;formaldehyde?
The InChIKey is GVNNIHSAJXXMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.CH2O/c8-4-5-6(9)2-1-3-7(5)10;1-2/h1-4,9-10H;1H2.
What are the key properties of 2,6-dihydroxybenzaldehyde;formaldehyde?
2,6-dihydroxybenzaldehyde;formaldehyde has a molecular weight of 168.15 g/mol, XLogP of 0.73, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dihydroxybenzaldehyde;formaldehyde is sourced from PubChem (CID 158378810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).