C10H10O3 — CID 170481439
4-(2,6-dihydroxyphenyl)but-3-enal (PubChem CID 170481439) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-(2,6-dihydroxyphenyl)but-3-enal.
| Compound Name | 4-(2,6-dihydroxyphenyl)but-3-enal |
|---|---|
| PubChem CID | 170481439 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4-(2,6-dihydroxyphenyl)but-3-enal |
| SMILES | O=CCC=Cc1c(O)cccc1O |
| InChI | InChI=1S/C10H10O3/c11-7-2-1-4-8-9(12)5-3-6-10(8)13/h1,3-7,12-13H,2H2 |
| InChIKey | YXZIIHUAOUATJN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|