C10H11ClO2 — CID 170498728
2-(4-chlorobut-1-enyl)benzene-1,3-diol (PubChem CID 170498728) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is 2-(4-chlorobut-1-enyl)benzene-1,3-diol.
| Compound Name | 2-(4-chlorobut-1-enyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 170498728 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 2-(4-chlorobut-1-enyl)benzene-1,3-diol |
| SMILES | Oc1cccc(O)c1C=CCCCl |
| InChI | InChI=1S/C10H11ClO2/c11-7-2-1-4-8-9(12)5-3-6-10(8)13/h1,3-6,12-13H,2,7H2 |
| InChIKey | RXPFOQNUBADNLR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|