About formaldehyde;naphthalene-1,5-diol
formaldehyde;naphthalene-1,5-diol (PubChem CID 21419428) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is formaldehyde;naphthalene-1,5-diol.
Molecular Properties
| Compound Name | formaldehyde;naphthalene-1,5-diol |
| PubChem CID | 21419428 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | formaldehyde;naphthalene-1,5-diol |
| SMILES | C=O.Oc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C10H8O2.CH2O/c11-9-5-1-3-7-8(9)4-2-6-10(7)12;1-2/h1-6,11-12H;1H2 |
| InChIKey | WYKVEUIBEMGZNT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formaldehyde;naphthalene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;naphthalene-1,5-diol?
The IUPAC name of formaldehyde;naphthalene-1,5-diol (CID 21419428) is formaldehyde;naphthalene-1,5-diol.
What is the SMILES notation for formaldehyde;naphthalene-1,5-diol?
The canonical SMILES for formaldehyde;naphthalene-1,5-diol is C=O.Oc1cccc2c(O)cccc12.
What is the InChIKey of formaldehyde;naphthalene-1,5-diol?
The InChIKey is WYKVEUIBEMGZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.CH2O/c11-9-5-1-3-7-8(9)4-2-6-10(7)12;1-2/h1-6,11-12H;1H2.
What are the key properties of formaldehyde;naphthalene-1,5-diol?
formaldehyde;naphthalene-1,5-diol has a molecular weight of 190.20 g/mol, XLogP of 2.07, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;naphthalene-1,5-diol is sourced from PubChem (CID 21419428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).