C11H15ClO4S — CID 171862580
3-chloro-1-[2-(methylsulfonylmethyl)phenyl]propane-1,2-diol (PubChem CID 171862580) has the molecular formula C11H15ClO4S and a molecular weight of 278.76 g/mol. Its IUPAC name is 3-chloro-1-[2-(methylsulfonylmethyl)phenyl]propane-1,2-diol.
| Compound Name | 3-chloro-1-[2-(methylsulfonylmethyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 171862580 |
| Molecular Formula | C11H15ClO4S |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 3-chloro-1-[2-(methylsulfonylmethyl)phenyl]propane-1,2-diol |
| SMILES | CS(=O)(=O)Cc1ccccc1C(O)C(O)CCl |
| InChI | InChI=1S/C11H15ClO4S/c1-17(15,16)7-8-4-2-3-5-9(8)11(14)10(13)6-12/h2-5,10-11,13-14H,6-7H2,1H3 |
| InChIKey | FQMLTVWEXDWRPW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|