C16H16O4 — CID 170818848
phenyl-[2-(1,2,3-trihydroxypropyl)phenyl]methanone (PubChem CID 170818848) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is phenyl-[2-(1,2,3-trihydroxypropyl)phenyl]methanone.
| Compound Name | phenyl-[2-(1,2,3-trihydroxypropyl)phenyl]methanone |
|---|---|
| PubChem CID | 170818848 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | phenyl-[2-(1,2,3-trihydroxypropyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1)c1ccccc1C(O)C(O)CO |
| InChI | InChI=1S/C16H16O4/c17-10-14(18)16(20)13-9-5-4-8-12(13)15(19)11-6-2-1-3-7-11/h1-9,14,16-18,20H,10H2 |
| InChIKey | LWBOHNPRLNVIOL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |