2-(1,2,3-trihydroxypropyl)terephthalic acid

C11H12O7 — CID 170818688

IUPAC2-(1,2,3-trihydroxypropyl)terephthalic acid
SMILESO=C(O)c1ccc(C(=O)O)c(C(O)C(O)CO)c1
InChIInChI=1S/C11H12O7/c12-4-8(13)9(14)7-3-5(10(15)16)1-2-6(7)11(17)18/h1-3,8-9,12-14H,4H2,(H,15,16)(H,17,18)
InChIKeyBBCLNSYKOGCUQA-UHFFFAOYSA-N
MW256.21 g/mol
LogP-0.53
Rot. Bonds5

About 2-(1,2,3-trihydroxypropyl)terephthalic acid

2-(1,2,3-trihydroxypropyl)terephthalic acid (PubChem CID 170818688) has the molecular formula C11H12O7 and a molecular weight of 256.21 g/mol. Its IUPAC name is 2-(1,2,3-trihydroxypropyl)terephthalic acid.

Molecular Properties

Compound Name2-(1,2,3-trihydroxypropyl)terephthalic acid
PubChem CID170818688
Molecular FormulaC11H12O7
Molecular Weight256.21 g/mol
Exact Mass256.06
IUPAC Name2-(1,2,3-trihydroxypropyl)terephthalic acid
SMILESO=C(O)c1ccc(C(=O)O)c(C(O)C(O)CO)c1
InChIInChI=1S/C11H12O7/c12-4-8(13)9(14)7-3-5(10(15)16)1-2-6(7)11(17)18/h1-3,8-9,12-14H,4H2,(H,15,16)(H,17,18)
InChIKeyBBCLNSYKOGCUQA-UHFFFAOYSA-N
XLogP-0.53
TPSA135.29 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.21
LogP ≤ 5-0.53
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze 2-(1,2,3-trihydroxypropyl)terephthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2,3-trihydroxypropyl)terephthalic acid?
The IUPAC name of 2-(1,2,3-trihydroxypropyl)terephthalic acid (CID 170818688) is 2-(1,2,3-trihydroxypropyl)terephthalic acid.
What is the SMILES notation for 2-(1,2,3-trihydroxypropyl)terephthalic acid?
The canonical SMILES for 2-(1,2,3-trihydroxypropyl)terephthalic acid is O=C(O)c1ccc(C(=O)O)c(C(O)C(O)CO)c1.
What is the InChIKey of 2-(1,2,3-trihydroxypropyl)terephthalic acid?
The InChIKey is BBCLNSYKOGCUQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O7/c12-4-8(13)9(14)7-3-5(10(15)16)1-2-6(7)11(17)18/h1-3,8-9,12-14H,4H2,(H,15,16)(H,17,18).
What are the key properties of 2-(1,2,3-trihydroxypropyl)terephthalic acid?
2-(1,2,3-trihydroxypropyl)terephthalic acid has a molecular weight of 256.21 g/mol, XLogP of -0.53, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,3-trihydroxypropyl)terephthalic acid is sourced from PubChem (CID 170818688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).