C8H11NO6S2 — CID 171877776
3,4-dihydroxy-4-(5-sulfamoylthiophen-2-yl)butanoic acid (PubChem CID 171877776) has the molecular formula C8H11NO6S2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(5-sulfamoylthiophen-2-yl)butanoic acid.
| Compound Name | 3,4-dihydroxy-4-(5-sulfamoylthiophen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 171877776 |
| Molecular Formula | C8H11NO6S2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 3,4-dihydroxy-4-(5-sulfamoylthiophen-2-yl)butanoic acid |
| SMILES | NS(=O)(=O)c1ccc(C(O)C(O)CC(=O)O)s1 |
| InChI | InChI=1S/C8H11NO6S2/c9-17(14,15)7-2-1-5(16-7)8(13)4(10)3-6(11)12/h1-2,4,8,10,13H,3H2,(H,11,12)(H2,9,14,15) |
| InChIKey | SCMCVNMBTFIYMF-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |