C13H13IN2O3S2 — CID 43246478
4-iodo-N-[1-(5-sulfamoylthiophen-2-yl)ethyl]benzamide (PubChem CID 43246478) has the molecular formula C13H13IN2O3S2 and a molecular weight of 436.30 g/mol. Its IUPAC name is 4-iodo-N-[1-(5-sulfamoylthiophen-2-yl)ethyl]benzamide.
| Compound Name | 4-iodo-N-[1-(5-sulfamoylthiophen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 43246478 |
| Molecular Formula | C13H13IN2O3S2 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.94 |
| IUPAC Name | 4-iodo-N-[1-(5-sulfamoylthiophen-2-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(I)cc1)c1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C13H13IN2O3S2/c1-8(11-6-7-12(20-11)21(15,18)19)16-13(17)9-2-4-10(14)5-3-9/h2-8H,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | DXPVIXDRYIQMMU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|