C14H14INO2S — CID 107731673
2-hydroxy-5-iodo-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide (PubChem CID 107731673) has the molecular formula C14H14INO2S and a molecular weight of 387.24 g/mol. Its IUPAC name is 2-hydroxy-5-iodo-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide.
| Compound Name | 2-hydroxy-5-iodo-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 107731673 |
| Molecular Formula | C14H14INO2S |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | 2-hydroxy-5-iodo-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2cc(I)ccc2O)s1 |
| InChI | InChI=1S/C14H14INO2S/c1-8-3-6-13(19-8)9(2)16-14(18)11-7-10(15)4-5-12(11)17/h3-7,9,17H,1-2H3,(H,16,18) |
| InChIKey | OWZGSHXKSJAYCE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|