C11H18N2O4S3 — CID 105361263
5-[1-(cyclopentylsulfonylamino)ethyl]thiophene-2-sulfonamide (PubChem CID 105361263) has the molecular formula C11H18N2O4S3 and a molecular weight of 338.48 g/mol. Its IUPAC name is 5-[1-(cyclopentylsulfonylamino)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-[1-(cyclopentylsulfonylamino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 105361263 |
| Molecular Formula | C11H18N2O4S3 |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 5-[1-(cyclopentylsulfonylamino)ethyl]thiophene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)C1CCCC1)c1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C11H18N2O4S3/c1-8(10-6-7-11(18-10)19(12,14)15)13-20(16,17)9-4-2-3-5-9/h6-9,13H,2-5H2,1H3,(H2,12,14,15) |
| InChIKey | SOYBLAGGHGMJIX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |