C15H16BrNOS — CID 102851500
4-(bromomethyl)-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide (PubChem CID 102851500) has the molecular formula C15H16BrNOS and a molecular weight of 338.27 g/mol. Its IUPAC name is 4-(bromomethyl)-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide.
| Compound Name | 4-(bromomethyl)-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 102851500 |
| Molecular Formula | C15H16BrNOS |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 4-(bromomethyl)-N-[1-(5-methylthiophen-2-yl)ethyl]benzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2ccc(CBr)cc2)s1 |
| InChI | InChI=1S/C15H16BrNOS/c1-10-3-8-14(19-10)11(2)17-15(18)13-6-4-12(9-16)5-7-13/h3-8,11H,9H2,1-2H3,(H,17,18) |
| InChIKey | UCYZSIPXNJUNMO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|