C8H14N2O4S3 — CID 43134149
5-[1-(ethylsulfonylamino)ethyl]thiophene-2-sulfonamide (PubChem CID 43134149) has the molecular formula C8H14N2O4S3 and a molecular weight of 298.41 g/mol. Its IUPAC name is 5-[1-(ethylsulfonylamino)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-[1-(ethylsulfonylamino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43134149 |
| Molecular Formula | C8H14N2O4S3 |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 5-[1-(ethylsulfonylamino)ethyl]thiophene-2-sulfonamide |
| SMILES | CCS(=O)(=O)NC(C)c1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C8H14N2O4S3/c1-3-16(11,12)10-6(2)7-4-5-8(15-7)17(9,13)14/h4-6,10H,3H2,1-2H3,(H2,9,13,14) |
| InChIKey | AFCWNKHSFVOEPJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |