C11H13N3O4S3 — CID 43134153
N-[1-(5-sulfamoylthiophen-2-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 43134153) has the molecular formula C11H13N3O4S3 and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[1-(5-sulfamoylthiophen-2-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | N-[1-(5-sulfamoylthiophen-2-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 43134153 |
| Molecular Formula | C11H13N3O4S3 |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | N-[1-(5-sulfamoylthiophen-2-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccnc1)c1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C11H13N3O4S3/c1-8(10-4-5-11(19-10)20(12,15)16)14-21(17,18)9-3-2-6-13-7-9/h2-8,14H,1H3,(H2,12,15,16) |
| InChIKey | JMHWFNJVUSTYJG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |