C22H22N4O8S2 — CID 142590055
[4-[(2S)-2-(pyridin-3-ylsulfonylamino)propanoyl]oxyphenyl] (2S)-2-(pyridin-3-ylsulfonylamino)propanoate (PubChem CID 142590055) has the molecular formula C22H22N4O8S2 and a molecular weight of 534.57 g/mol. Its IUPAC name is [4-[(2S)-2-(pyridin-3-ylsulfonylamino)propanoyl]oxyphenyl] (2S)-2-(pyridin-3-ylsulfonylamino)propanoate.
| Compound Name | [4-[(2S)-2-(pyridin-3-ylsulfonylamino)propanoyl]oxyphenyl] (2S)-2-(pyridin-3-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 142590055 |
| Molecular Formula | C22H22N4O8S2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | [4-[(2S)-2-(pyridin-3-ylsulfonylamino)propanoyl]oxyphenyl] (2S)-2-(pyridin-3-ylsulfonylamino)propanoate |
| SMILES | C[C@H](NS(=O)(=O)c1cccnc1)C(=O)Oc1ccc(OC(=O)[C@H](C)NS(=O)(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C22H22N4O8S2/c1-15(25-35(29,30)19-5-3-11-23-13-19)21(27)33-17-7-9-18(10-8-17)34-22(28)16(2)26-36(31,32)20-6-4-12-24-14-20/h3-16,25-26H,1-2H3/t15-,16-/m0/s1 |
| InChIKey | PHMUTGPANZHFOB-HOTGVXAUSA-N |
| XLogP | 1.02 |
| TPSA | 170.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|