C12H22N2O4S3 — CID 103521332
5-[1-(3,3-dimethylbutylsulfonylamino)ethyl]thiophene-2-sulfonamide (PubChem CID 103521332) has the molecular formula C12H22N2O4S3 and a molecular weight of 354.52 g/mol. Its IUPAC name is 5-[1-(3,3-dimethylbutylsulfonylamino)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-[1-(3,3-dimethylbutylsulfonylamino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103521332 |
| Molecular Formula | C12H22N2O4S3 |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 5-[1-(3,3-dimethylbutylsulfonylamino)ethyl]thiophene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)CCC(C)(C)C)c1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C12H22N2O4S3/c1-9(10-5-6-11(19-10)21(13,17)18)14-20(15,16)8-7-12(2,3)4/h5-6,9,14H,7-8H2,1-4H3,(H2,13,17,18) |
| InChIKey | CTCLOFAOYOHUNO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |