About 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid
4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid (PubChem CID 171866983) has the molecular formula C13H16O7S
and a molecular weight of 316.33 g/mol. Its IUPAC name is 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid |
| PubChem CID | 171866983 |
| Molecular Formula | C13H16O7S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(C(=O)CCC(=O)O)s1 |
| InChI | InChI=1S/C13H16O7S/c1-2-20-13(19)12(18)11(17)9-5-4-8(21-9)7(14)3-6-10(15)16/h4-5,11-12,17-18H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | UKLHPLXJIOZVOJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid?
The IUPAC name of 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid (CID 171866983) is 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid.
What is the SMILES notation for 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid?
The canonical SMILES for 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid is CCOC(=O)C(O)C(O)c1ccc(C(=O)CCC(=O)O)s1.
What is the InChIKey of 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid?
The InChIKey is UKLHPLXJIOZVOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O7S/c1-2-20-13(19)12(18)11(17)9-5-4-8(21-9)7(14)3-6-10(15)16/h4-5,11-12,17-18H,2-3,6H2,1H3,(H,15,16).
What are the key properties of 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid?
4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid has a molecular weight of 316.33 g/mol, XLogP of 0.75, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]-4-oxobutanoic acid is sourced from PubChem (CID 171866983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).