C12H13NO5S — CID 171901848
ethyl 2-[5-(3-cyano-1,2-dihydroxypropyl)thiophen-2-yl]-2-oxoacetate (PubChem CID 171901848) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is ethyl 2-[5-(3-cyano-1,2-dihydroxypropyl)thiophen-2-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[5-(3-cyano-1,2-dihydroxypropyl)thiophen-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 171901848 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | ethyl 2-[5-(3-cyano-1,2-dihydroxypropyl)thiophen-2-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1ccc(C(O)C(O)CC#N)s1 |
| InChI | InChI=1S/C12H13NO5S/c1-2-18-12(17)11(16)9-4-3-8(19-9)10(15)7(14)5-6-13/h3-4,7,10,14-15H,2,5H2,1H3 |
| InChIKey | XVMGTKYMGYYXBE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|