About ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate
ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate (PubChem CID 171901244) has the molecular formula C11H13NO4S
and a molecular weight of 255.29 g/mol. Its IUPAC name is ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate.
Analyze ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate?
The IUPAC name of ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate (CID 171901244) is ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate.
What is the SMILES notation for ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate?
The canonical SMILES for ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate is CCOC(=O)c1ccc(C(O)C(O)CC#N)s1.
What is the InChIKey of ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate?
The InChIKey is AKHGIPNRTANYRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4S/c1-2-16-11(15)9-4-3-8(17-9)10(14)7(13)5-6-12/h3-4,7,10,13-14H,2,5H2,1H3.
What are the key properties of ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate?
ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate has a molecular weight of 255.29 g/mol, XLogP of 1.23, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(3-cyano-1,2-dihydroxypropyl)thiophene-2-carboxylate is sourced from PubChem (CID 171901244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).